bleeeeh1621 bleeeeh1621

03-04-2018
Geography

contestada

What climate factor is responsible for the snow on mt kilimanjaro?

Respuesta :

perezkatheryn1 perezkatheryn1

03-04-2018

High elevation is the climate factor responsible for the snow on Mount Kilimanjaro.

Answer Link

Otras preguntas

Which of the following statements describes how the Punic Wars contributed to the development of the Roman Empire? They allowed the Romans to focus more on e

estimate the sum of 672 and 830 by rounding to the nearest hundred before adding

What is the opposite of the number -3 1/4 ? A. -4 1/3 B. -4/13 C. 3 1/4 D. 4 1/3

What European power was defeated in Ethiopia in its attempt to control the country?

if salinity increased, would that affect animal and plant life ?

Is this all correct?

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

Amandas library boks weigh 4 3/8 pounds, and her water bottle weighs 1 7/16 pounds. What is the total weight of her books and water bottle? Please make sure the

Which of the following would you use to view organelles? hand lens compound light microscope electron microscope basic light microscope

What was the dividing border between North and South Korea set by the United States and the Soviet Union?